C35H30N3O4PS — CID 11192867
diethyl 2-(phenyliminomethylideneamino)-5-[(triphenyl-λ5-phosphanylidene)amino]thiophene-3,4-dicarboxylate (PubChem CID 11192867) has the molecular formula C35H30N3O4PS and a molecular weight of 619.68 g/mol. Its IUPAC name is diethyl 2-(phenyliminomethylideneamino)-5-[(triphenyl-λ5-phosphanylidene)amino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2-(phenyliminomethylideneamino)-5-[(triphenyl-λ5-phosphanylidene)amino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11192867 |
| Molecular Formula | C35H30N3O4PS |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | diethyl 2-(phenyliminomethylideneamino)-5-[(triphenyl-λ5-phosphanylidene)amino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(N=C=Nc2ccccc2)sc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C35H30N3O4PS/c1-3-41-34(39)30-31(35(40)42-4-2)33(44-32(30)37-25-36-26-17-9-5-10-18-26)38-43(27-19-11-6-12-20-27,28-21-13-7-14-22-28)29-23-15-8-16-24-29/h5-24H,3-4H2,1-2H3 |
| InChIKey | HQTIKYMSHUUIBS-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|