C21H20BrN3O2S — CID 136901515
ethyl 2-(2-bromoethylamino)-4-phenyl-5-phenyldiazenylthiophene-3-carboxylate (PubChem CID 136901515) has the molecular formula C21H20BrN3O2S and a molecular weight of 458.38 g/mol. Its IUPAC name is ethyl 2-(2-bromoethylamino)-4-phenyl-5-phenyldiazenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-bromoethylamino)-4-phenyl-5-phenyldiazenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 136901515 |
| Molecular Formula | C21H20BrN3O2S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | ethyl 2-(2-bromoethylamino)-4-phenyl-5-phenyldiazenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NCCBr)sc(/N=N/c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H20BrN3O2S/c1-2-27-21(26)18-17(15-9-5-3-6-10-15)20(28-19(18)23-14-13-22)25-24-16-11-7-4-8-12-16/h3-12,23H,2,13-14H2,1H3/b25-24+ |
| InChIKey | YQQHJDAOGKKSRF-OCOZRVBESA-N |
| XLogP | 6.81 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|