About ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate
ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate (PubChem CID 11547716) has the molecular formula C29H25N4O2P
and a molecular weight of 492.52 g/mol. Its IUPAC name is ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate |
| PubChem CID | 11547716 |
| Molecular Formula | C29H25N4O2P |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(-c2ccccc2)c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25N4O2P/c1-2-35-29(34)27-28(33(32-30-27)23-15-7-3-8-16-23)31-36(24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,2H2,1H3 |
| InChIKey | DXLFQJQUFWWPFQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate?
The IUPAC name of ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate (CID 11547716) is ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate.
What is the SMILES notation for ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate?
The canonical SMILES for ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate is CCOC(=O)c1nnn(-c2ccccc2)c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate?
The InChIKey is DXLFQJQUFWWPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25N4O2P/c1-2-35-29(34)27-28(33(32-30-27)23-15-7-3-8-16-23)31-36(24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,2H2,1H3.
What are the key properties of ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate?
ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate has a molecular weight of 492.52 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-phenyl-5-[(triphenyl-λ5-phosphanylidene)amino]triazole-4-carboxylate is sourced from PubChem (CID 11547716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).