C25H23N2O2PS2 — CID 10896100
ethyl 2-methylsulfanyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3-thiazole-5-carboxylate (PubChem CID 10896100) has the molecular formula C25H23N2O2PS2 and a molecular weight of 478.58 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 10896100 |
| Molecular Formula | C25H23N2O2PS2 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-[(triphenyl-λ5-phosphanylidene)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)nc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N2O2PS2/c1-3-29-24(28)22-23(26-25(31-2)32-22)27-30(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,3H2,1-2H3 |
| InChIKey | UHORLGIOJUIEHI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|