C13H15BrN4O2S — CID 18322831
ethyl 2-(diaminomethylideneamino)-4-phenyl-1,3-thiazole-5-carboxylate;hydrobromide (PubChem CID 18322831) has the molecular formula C13H15BrN4O2S and a molecular weight of 371.26 g/mol. Its IUPAC name is ethyl 2-(diaminomethylideneamino)-4-phenyl-1,3-thiazole-5-carboxylate;hydrobromide.
| Compound Name | ethyl 2-(diaminomethylideneamino)-4-phenyl-1,3-thiazole-5-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 18322831 |
| Molecular Formula | C13H15BrN4O2S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | ethyl 2-(diaminomethylideneamino)-4-phenyl-1,3-thiazole-5-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1sc(N=C(N)N)nc1-c1ccccc1 |
| InChI | InChI=1S/C13H14N4O2S.BrH/c1-2-19-11(18)10-9(8-6-4-3-5-7-8)16-13(20-10)17-12(14)15;/h3-7H,2H2,1H3,(H4,14,15,16,17);1H |
| InChIKey | QGHZWHGVXLIALP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|