C16H14N4S — CID 3147443
2-(4,5-diphenyl-1,3-thiazol-2-yl)guanidine (PubChem CID 3147443) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1,3-thiazol-2-yl)guanidine.
| Compound Name | 2-(4,5-diphenyl-1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 3147443 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(4,5-diphenyl-1,3-thiazol-2-yl)guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H14N4S/c17-15(18)20-16-19-13(11-7-3-1-4-8-11)14(21-16)12-9-5-2-6-10-12/h1-10H,(H4,17,18,19,20) |
| InChIKey | DWFQFNLFBHTXJN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|