C15H11ClN2S — CID 2806452
4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine (PubChem CID 2806452) has the molecular formula C15H11ClN2S and a molecular weight of 286.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2806452 |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(Cl)cc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H11ClN2S/c16-12-8-6-10(7-9-12)13-14(19-15(17)18-13)11-4-2-1-3-5-11/h1-9H,(H2,17,18) |
| InChIKey | VTLCTTGVROTXOJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |