C15H8BrCl2NS — CID 21409105
2-bromo-4,5-bis(4-chlorophenyl)-1,3-thiazole (PubChem CID 21409105) has the molecular formula C15H8BrCl2NS and a molecular weight of 385.11 g/mol. Its IUPAC name is 2-bromo-4,5-bis(4-chlorophenyl)-1,3-thiazole.
| Compound Name | 2-bromo-4,5-bis(4-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 21409105 |
| Molecular Formula | C15H8BrCl2NS |
| Molecular Weight | 385.11 g/mol |
| Exact Mass | 382.89 |
| IUPAC Name | 2-bromo-4,5-bis(4-chlorophenyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2nc(Br)sc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H8BrCl2NS/c16-15-19-13(9-1-5-11(17)6-2-9)14(20-15)10-3-7-12(18)8-4-10/h1-8H |
| InChIKey | NAAOAIKHUHFKAX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.11 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |