C12H8ClN3S2 — CID 82106922
5-(4-chlorophenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 82106922) has the molecular formula C12H8ClN3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82106922 |
| Molecular Formula | C12H8ClN3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2nccs2)c(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C12H8ClN3S2/c13-8-3-1-7(2-4-8)10-9(16-12(14)18-10)11-15-5-6-17-11/h1-6H,(H2,14,16) |
| InChIKey | CUYLPVUFIHDUIK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |