C15H14BrClN2OS — CID 134095812
4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine;hydrate;hydrobromide (PubChem CID 134095812) has the molecular formula C15H14BrClN2OS and a molecular weight of 385.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine;hydrate;hydrobromide.
| Compound Name | 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine;hydrate;hydrobromide |
|---|---|
| PubChem CID | 134095812 |
| Molecular Formula | C15H14BrClN2OS |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-amine;hydrate;hydrobromide |
| SMILES | Br.Nc1nc(-c2ccc(Cl)cc2)c(-c2ccccc2)s1.O |
| InChI | InChI=1S/C15H11ClN2S.BrH.H2O/c16-12-8-6-10(7-9-12)13-14(19-15(17)18-13)11-4-2-1-3-5-11;;/h1-9H,(H2,17,18);1H;1H2 |
| InChIKey | QOBMEWZELPXIHR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |