C13H9ClN2S2 — CID 82106545
5-(3-chlorophenyl)-4-thiophen-3-yl-1,3-thiazol-2-amine (PubChem CID 82106545) has the molecular formula C13H9ClN2S2 and a molecular weight of 292.82 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4-thiophen-3-yl-1,3-thiazol-2-amine.
| Compound Name | 5-(3-chlorophenyl)-4-thiophen-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82106545 |
| Molecular Formula | C13H9ClN2S2 |
| Molecular Weight | 292.82 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 5-(3-chlorophenyl)-4-thiophen-3-yl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccsc2)c(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C13H9ClN2S2/c14-10-3-1-2-8(6-10)12-11(16-13(15)18-12)9-4-5-17-7-9/h1-7H,(H2,15,16) |
| InChIKey | ZMSIAVZNKNJXAP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazole_amine_L(1)', 'substructure': 'N/A'} |
|---|