About 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine
5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine (PubChem CID 87896523) has the molecular formula C20H21ClN4S
and a molecular weight of 384.94 g/mol. Its IUPAC name is 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine |
| PubChem CID | 87896523 |
| Molecular Formula | C20H21ClN4S |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(Cl)c2)c(-c2ccnc(C3(N)CCCCC3)c2)s1 |
| InChI | InChI=1S/C20H21ClN4S/c21-15-6-4-5-13(11-15)17-18(26-19(22)25-17)14-7-10-24-16(12-14)20(23)8-2-1-3-9-20/h4-7,10-12H,1-3,8-9,23H2,(H2,22,25) |
| InChIKey | ABLJPRTZWSAODT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine (CID 87896523) is 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine is Nc1nc(-c2cccc(Cl)c2)c(-c2ccnc(C3(N)CCCCC3)c2)s1.
What is the InChIKey of 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine?
The InChIKey is ABLJPRTZWSAODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN4S/c21-15-6-4-5-13(11-15)17-18(26-19(22)25-17)14-7-10-24-16(12-14)20(23)8-2-1-3-9-20/h4-7,10-12H,1-3,8-9,23H2,(H2,22,25).
What are the key properties of 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine?
5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine has a molecular weight of 384.94 g/mol, XLogP of 5.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1-aminocyclohexyl)-4-pyridinyl]-4-(3-chlorophenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 87896523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).