C15H10Cl2N2OS — CID 88924571
5-(4-chlorophenoxy)-4-(3-chlorophenyl)-1,3-thiazol-2-amine (PubChem CID 88924571) has the molecular formula C15H10Cl2N2OS and a molecular weight of 337.23 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-4-(3-chlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chlorophenoxy)-4-(3-chlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 88924571 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-(4-chlorophenoxy)-4-(3-chlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(Cl)c2)c(Oc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H10Cl2N2OS/c16-10-4-6-12(7-5-10)20-14-13(19-15(18)21-14)9-2-1-3-11(17)8-9/h1-8H,(H2,18,19) |
| InChIKey | MDZBPRSACMGQJN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |