C11H8N4S — CID 119094972
6-(1,3-thiazol-2-yl)quinoxalin-2-amine (PubChem CID 119094972) has the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-yl)quinoxalin-2-amine.
| Compound Name | 6-(1,3-thiazol-2-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 119094972 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 6-(1,3-thiazol-2-yl)quinoxalin-2-amine |
| SMILES | Nc1cnc2cc(-c3nccs3)ccc2n1 |
| InChI | InChI=1S/C11H8N4S/c12-10-6-14-9-5-7(1-2-8(9)15-10)11-13-3-4-16-11/h1-6H,(H2,12,15) |
| InChIKey | HFLLZXFPWACOJC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |