About 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione
9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione (PubChem CID 155690295) has the molecular formula C18H8N4O2S
and a molecular weight of 344.36 g/mol. Its IUPAC name is 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione.
Molecular Properties
| Compound Name | 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione |
| PubChem CID | 155690295 |
| Molecular Formula | C18H8N4O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1c2cccnc2C(=O)c2nc3cc(-c4nccs4)ccc3nc21 |
| InChI | InChI=1S/C18H8N4O2S/c23-16-10-2-1-5-19-13(10)17(24)15-14(16)21-11-4-3-9(8-12(11)22-15)18-20-6-7-25-18/h1-8H |
| InChIKey | NQUFIZTVFLGDCL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione?
The IUPAC name of 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione (CID 155690295) is 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione.
What is the SMILES notation for 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione?
The canonical SMILES for 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione is O=C1c2cccnc2C(=O)c2nc3cc(-c4nccs4)ccc3nc21.
What is the InChIKey of 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione?
The InChIKey is NQUFIZTVFLGDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8N4O2S/c23-16-10-2-1-5-19-13(10)17(24)15-14(16)21-11-4-3-9(8-12(11)22-15)18-20-6-7-25-18/h1-8H.
What are the key properties of 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione?
9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione has a molecular weight of 344.36 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,3-thiazol-2-yl)pyrido[3,2-b]phenazine-5,12-dione is sourced from PubChem (CID 155690295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).