About 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione
9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione (PubChem CID 157105914) has the molecular formula C20H13F3N4O2
and a molecular weight of 398.34 g/mol. Its IUPAC name is 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione.
Molecular Properties
| Compound Name | 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione |
| PubChem CID | 157105914 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1c2cccnc2C(=O)c2nc3cc(N4CCCC4)c(C(F)(F)F)cc3nc21 |
| InChI | InChI=1S/C20H13F3N4O2/c21-20(22,23)11-8-12-13(9-14(11)27-6-1-2-7-27)26-17-16(25-12)18(28)10-4-3-5-24-15(10)19(17)29/h3-5,8-9H,1-2,6-7H2 |
| InChIKey | AGHKKFGDIQQJGX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione?
The IUPAC name of 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione (CID 157105914) is 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione.
What is the SMILES notation for 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione?
The canonical SMILES for 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione is O=C1c2cccnc2C(=O)c2nc3cc(N4CCCC4)c(C(F)(F)F)cc3nc21.
What is the InChIKey of 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione?
The InChIKey is AGHKKFGDIQQJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N4O2/c21-20(22,23)11-8-12-13(9-14(11)27-6-1-2-7-27)26-17-16(25-12)18(28)10-4-3-5-24-15(10)19(17)29/h3-5,8-9H,1-2,6-7H2.
What are the key properties of 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione?
9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione has a molecular weight of 398.34 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pyrrolidin-1-yl-8-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione is sourced from PubChem (CID 157105914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).