C21H19ClN2O2 — CID 165021121
7-chloro-6-[(4-piperidin-1-ylphenyl)methyl]quinoline-5,8-dione (PubChem CID 165021121) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 7-chloro-6-[(4-piperidin-1-ylphenyl)methyl]quinoline-5,8-dione.
| Compound Name | 7-chloro-6-[(4-piperidin-1-ylphenyl)methyl]quinoline-5,8-dione |
|---|---|
| PubChem CID | 165021121 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 7-chloro-6-[(4-piperidin-1-ylphenyl)methyl]quinoline-5,8-dione |
| SMILES | O=C1C(Cc2ccc(N3CCCCC3)cc2)=C(Cl)C(=O)c2ncccc21 |
| InChI | InChI=1S/C21H19ClN2O2/c22-18-17(20(25)16-5-4-10-23-19(16)21(18)26)13-14-6-8-15(9-7-14)24-11-2-1-3-12-24/h4-10H,1-3,11-13H2 |
| InChIKey | LEGPNHWSFRLYHM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|