C21H17ClF3N3O2 — CID 165046397
7-chloro-6-[[2,3,6-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]methyl]quinoline-5,8-dione (PubChem CID 165046397) has the molecular formula C21H17ClF3N3O2 and a molecular weight of 435.83 g/mol. Its IUPAC name is 7-chloro-6-[[2,3,6-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]methyl]quinoline-5,8-dione.
| Compound Name | 7-chloro-6-[[2,3,6-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]methyl]quinoline-5,8-dione |
|---|---|
| PubChem CID | 165046397 |
| Molecular Formula | C21H17ClF3N3O2 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 7-chloro-6-[[2,3,6-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]methyl]quinoline-5,8-dione |
| SMILES | CN1CCN(c2cc(F)c(CC3=C(Cl)C(=O)c4ncccc4C3=O)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H17ClF3N3O2/c1-27-5-7-28(8-6-27)15-10-14(23)12(17(24)18(15)25)9-13-16(22)21(30)19-11(20(13)29)3-2-4-26-19/h2-4,10H,5-9H2,1H3 |
| InChIKey | OYXHGEWEWNIQMG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|