C20H16ClN5O2 — CID 155690294
10-chloro-9-(4-methylpiperazin-1-yl)pyrido[3,2-b]phenazine-5,12-dione (PubChem CID 155690294) has the molecular formula C20H16ClN5O2 and a molecular weight of 393.83 g/mol. Its IUPAC name is 10-chloro-9-(4-methylpiperazin-1-yl)pyrido[3,2-b]phenazine-5,12-dione.
| Compound Name | 10-chloro-9-(4-methylpiperazin-1-yl)pyrido[3,2-b]phenazine-5,12-dione |
|---|---|
| PubChem CID | 155690294 |
| Molecular Formula | C20H16ClN5O2 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 10-chloro-9-(4-methylpiperazin-1-yl)pyrido[3,2-b]phenazine-5,12-dione |
| SMILES | CN1CCN(c2ccc3nc4c(nc3c2Cl)C(=O)c2ncccc2C4=O)CC1 |
| InChI | InChI=1S/C20H16ClN5O2/c1-25-7-9-26(10-8-25)13-5-4-12-16(14(13)21)24-18-17(23-12)19(27)11-3-2-6-22-15(11)20(18)28/h2-6H,7-10H2,1H3 |
| InChIKey | AOYVMLUARRJWNE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|