About 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione
9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione (PubChem CID 155690252) has the molecular formula C18H11N3O2
and a molecular weight of 301.31 g/mol. Its IUPAC name is 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione.
Molecular Properties
| Compound Name | 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione |
| PubChem CID | 155690252 |
| Molecular Formula | C18H11N3O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1c2cccnc2C(=O)c2nc3cc(C4CC4)ccc3nc21 |
| InChI | InChI=1S/C18H11N3O2/c22-17-11-2-1-7-19-14(11)18(23)16-15(17)20-12-6-5-10(9-3-4-9)8-13(12)21-16/h1-2,5-9H,3-4H2 |
| InChIKey | COJXVGAFOXGLNI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione?
The IUPAC name of 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione (CID 155690252) is 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione.
What is the SMILES notation for 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione?
The canonical SMILES for 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione is O=C1c2cccnc2C(=O)c2nc3cc(C4CC4)ccc3nc21.
What is the InChIKey of 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione?
The InChIKey is COJXVGAFOXGLNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O2/c22-17-11-2-1-7-19-14(11)18(23)16-15(17)20-12-6-5-10(9-3-4-9)8-13(12)21-16/h1-2,5-9H,3-4H2.
What are the key properties of 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione?
9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione has a molecular weight of 301.31 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione is sourced from PubChem (CID 155690252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).