C18H11N3O2 — CID 155690252
9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione (PubChem CID 155690252) has the molecular formula C18H11N3O2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione.
| Compound Name | 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione |
|---|---|
| PubChem CID | 155690252 |
| Molecular Formula | C18H11N3O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 9-cyclopropylpyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1c2cccnc2C(=O)c2nc3cc(C4CC4)ccc3nc21 |
| InChI | InChI=1S/C18H11N3O2/c22-17-11-2-1-7-19-14(11)18(23)16-15(17)20-12-6-5-10(9-3-4-9)8-13(12)21-16/h1-2,5-9H,3-4H2 |
| InChIKey | COJXVGAFOXGLNI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|