About naphtho[3,2-f]quinoxaline-7,12-dione
naphtho[3,2-f]quinoxaline-7,12-dione (PubChem CID 12567021) has the molecular formula C16H8N2O2
and a molecular weight of 260.25 g/mol. Its IUPAC name is naphtho[3,2-f]quinoxaline-7,12-dione.
Molecular Properties
| Compound Name | naphtho[3,2-f]quinoxaline-7,12-dione |
| PubChem CID | 12567021 |
| Molecular Formula | C16H8N2O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | naphtho[3,2-f]quinoxaline-7,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1nccnc21 |
| InChI | InChI=1S/C16H8N2O2/c19-15-9-3-1-2-4-10(9)16(20)13-11(15)5-6-12-14(13)18-8-7-17-12/h1-8H |
| InChIKey | DGLSEJAACVWJNU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze naphtho[3,2-f]quinoxaline-7,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[3,2-f]quinoxaline-7,12-dione?
The IUPAC name of naphtho[3,2-f]quinoxaline-7,12-dione (CID 12567021) is naphtho[3,2-f]quinoxaline-7,12-dione.
What is the SMILES notation for naphtho[3,2-f]quinoxaline-7,12-dione?
The canonical SMILES for naphtho[3,2-f]quinoxaline-7,12-dione is O=C1c2ccccc2C(=O)c2c1ccc1nccnc21.
What is the InChIKey of naphtho[3,2-f]quinoxaline-7,12-dione?
The InChIKey is DGLSEJAACVWJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2O2/c19-15-9-3-1-2-4-10(9)16(20)13-11(15)5-6-12-14(13)18-8-7-17-12/h1-8H.
What are the key properties of naphtho[3,2-f]quinoxaline-7,12-dione?
naphtho[3,2-f]quinoxaline-7,12-dione has a molecular weight of 260.25 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[3,2-f]quinoxaline-7,12-dione is sourced from PubChem (CID 12567021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).