C25H19N5O3 — CID 155690289
9-[4-(4-hydroxyphenyl)piperazin-1-yl]pyrido[3,2-b]phenazine-5,12-dione (PubChem CID 155690289) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 9-[4-(4-hydroxyphenyl)piperazin-1-yl]pyrido[3,2-b]phenazine-5,12-dione.
| Compound Name | 9-[4-(4-hydroxyphenyl)piperazin-1-yl]pyrido[3,2-b]phenazine-5,12-dione |
|---|---|
| PubChem CID | 155690289 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 9-[4-(4-hydroxyphenyl)piperazin-1-yl]pyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1c2cccnc2C(=O)c2nc3cc(N4CCN(c5ccc(O)cc5)CC4)ccc3nc21 |
| InChI | InChI=1S/C25H19N5O3/c31-17-6-3-15(4-7-17)29-10-12-30(13-11-29)16-5-8-19-20(14-16)28-23-22(27-19)24(32)18-2-1-9-26-21(18)25(23)33/h1-9,14,31H,10-13H2 |
| InChIKey | KARNPIRZLGDJOI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|