C18H19N3O2 — CID 10425439
4-[4-(furo[3,2-b]pyridin-2-ylmethyl)piperazin-1-yl]phenol (PubChem CID 10425439) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[4-(furo[3,2-b]pyridin-2-ylmethyl)piperazin-1-yl]phenol.
| Compound Name | 4-[4-(furo[3,2-b]pyridin-2-ylmethyl)piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 10425439 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[4-(furo[3,2-b]pyridin-2-ylmethyl)piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(Cc3cc4ncccc4o3)CC2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c22-15-5-3-14(4-6-15)21-10-8-20(9-11-21)13-16-12-17-18(23-16)2-1-7-19-17/h1-7,12,22H,8-11,13H2 |
| InChIKey | GMXJZSVUZMUKHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |