C21H22BrN3O2 — CID 171541814
7-bromo-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]quinolin-8-ol (PubChem CID 171541814) has the molecular formula C21H22BrN3O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 7-bromo-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]quinolin-8-ol.
| Compound Name | 7-bromo-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 171541814 |
| Molecular Formula | C21H22BrN3O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 7-bromo-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]quinolin-8-ol |
| SMILES | COc1ccc(N2CCN(Cc3cc(Br)c(O)c4ncccc34)CC2)cc1 |
| InChI | InChI=1S/C21H22BrN3O2/c1-27-17-6-4-16(5-7-17)25-11-9-24(10-12-25)14-15-13-19(22)21(26)20-18(15)3-2-8-23-20/h2-8,13,26H,9-12,14H2,1H3 |
| InChIKey | OHUKDCKPMSSANN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|