C20H25BrN2O3 — CID 8587506
1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 8587506) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 8587506 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(Cc3cc(OC)c(Br)cc3OC)CC2)cc1 |
| InChI | InChI=1S/C20H25BrN2O3/c1-24-17-6-4-16(5-7-17)23-10-8-22(9-11-23)14-15-12-20(26-3)18(21)13-19(15)25-2/h4-7,12-13H,8-11,14H2,1-3H3 |
| InChIKey | LPJIIELXAYEZFP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|