C15H23BrN2O2 — CID 782375
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-ethylpiperazine (PubChem CID 782375) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-ethylpiperazine.
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 782375 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(Cc2cc(OC)c(OC)cc2Br)CC1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-4-17-5-7-18(8-6-17)11-12-9-14(19-2)15(20-3)10-13(12)16/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | NPJIGTSWJRKSFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |