C20H30BrClN2O4 — CID 6734023
6-chlorohexyl 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 6734023) has the molecular formula C20H30BrClN2O4 and a molecular weight of 477.83 g/mol. Its IUPAC name is 6-chlorohexyl 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 6-chlorohexyl 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6734023 |
| Molecular Formula | C20H30BrClN2O4 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 6-chlorohexyl 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1cc(Br)c(CN2CCN(C(=O)OCCCCCCCl)CC2)cc1OC |
| InChI | InChI=1S/C20H30BrClN2O4/c1-26-18-13-16(17(21)14-19(18)27-2)15-23-8-10-24(11-9-23)20(25)28-12-6-4-3-5-7-22/h13-14H,3-12,15H2,1-2H3 |
| InChIKey | BVGIQEDOHBQQPC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|