C18H19N3O2 — CID 22065970
2-[[4-(1-oxidopyridin-1-ium-2-yl)piperidin-1-yl]methyl]furo[3,2-b]pyridine (PubChem CID 22065970) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[4-(1-oxidopyridin-1-ium-2-yl)piperidin-1-yl]methyl]furo[3,2-b]pyridine.
| Compound Name | 2-[[4-(1-oxidopyridin-1-ium-2-yl)piperidin-1-yl]methyl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 22065970 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[[4-(1-oxidopyridin-1-ium-2-yl)piperidin-1-yl]methyl]furo[3,2-b]pyridine |
| SMILES | [O-][n+]1ccccc1C1CCN(Cc2cc3ncccc3o2)CC1 |
| InChI | InChI=1S/C18H19N3O2/c22-21-9-2-1-4-17(21)14-6-10-20(11-7-14)13-15-12-16-18(23-15)5-3-8-19-16/h1-5,8-9,12,14H,6-7,10-11,13H2 |
| InChIKey | UKUXQYNZXXRSBC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|