C20H18ClN3O3 — CID 171715791
7-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-5,8-dione (PubChem CID 171715791) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 7-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-5,8-dione.
| Compound Name | 7-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-5,8-dione |
|---|---|
| PubChem CID | 171715791 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 7-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]quinoline-5,8-dione |
| SMILES | COc1ccc(N2CCN(C3=C(Cl)C(=O)c4ncccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-27-14-6-4-13(5-7-14)23-9-11-24(12-10-23)18-16(21)20(26)17-15(19(18)25)3-2-8-22-17/h2-8H,9-12H2,1H3 |
| InChIKey | WSYKTLXHXCUNGY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|