C14H21ClN2O3S — CID 43654044
1-(3-chloropropylsulfonyl)-4-(4-methoxyphenyl)piperazine (PubChem CID 43654044) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 1-(3-chloropropylsulfonyl)-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-(3-chloropropylsulfonyl)-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 43654044 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(3-chloropropylsulfonyl)-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CCCCl)CC2)cc1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-20-14-5-3-13(4-6-14)16-8-10-17(11-9-16)21(18,19)12-2-7-15/h3-6H,2,7-12H2,1H3 |
| InChIKey | SRZFVGREZSFPHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|