C18H25N3O5S — CID 27456819
1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 27456819) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 27456819 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CCN3C(=O)CCCC3=O)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-26-16-7-5-15(6-8-16)19-9-11-20(12-10-19)27(24,25)14-13-21-17(22)3-2-4-18(21)23/h5-8H,2-4,9-14H2,1H3 |
| InChIKey | WAMURVHJSQJRDA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|