C19H24ClN3O5S2 — CID 22578930
4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]benzenesulfonamide (PubChem CID 22578930) has the molecular formula C19H24ClN3O5S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22578930 |
| Molecular Formula | C19H24ClN3O5S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylethyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)CCNS(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H24ClN3O5S2/c1-28-18-6-4-17(5-7-18)22-11-13-23(14-12-22)29(24,25)15-10-21-30(26,27)19-8-2-16(20)3-9-19/h2-9,21H,10-15H2,1H3 |
| InChIKey | PVASSLDLABSHNM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|