C21H32N6O4S — CID 122336212
1-[2-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 122336212) has the molecular formula C21H32N6O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[2-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 122336212 |
| Molecular Formula | C21H32N6O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-[2-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | CC1CCN(c2ccc(N3CCN(S(=O)(=O)CCN4C(=O)CCCC4=O)CC3)nn2)CC1 |
| InChI | InChI=1S/C21H32N6O4S/c1-17-7-9-24(10-8-17)18-5-6-19(23-22-18)25-11-13-26(14-12-25)32(30,31)16-15-27-20(28)3-2-4-21(27)29/h5-6,17H,2-4,7-16H2,1H3 |
| InChIKey | FHWOKWWGRRDTSG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 107.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|