C16H24N4O4S — CID 90493899
1-[2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 90493899) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 90493899 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-[2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)N1CCC(Cn2ccnc2)CC1 |
| InChI | InChI=1S/C16H24N4O4S/c21-15-2-1-3-16(22)20(15)10-11-25(23,24)19-7-4-14(5-8-19)12-18-9-6-17-13-18/h6,9,13-14H,1-5,7-8,10-12H2 |
| InChIKey | ZYCDUYHHJVPEAF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|