C15H20N4O5S — CID 90638515
1-[2-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylethyl]piperidine-2,6-dione (PubChem CID 90638515) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 1-[2-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 90638515 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-[2-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylethyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)N1CCC(Oc2cccnn2)C1 |
| InChI | InChI=1S/C15H20N4O5S/c20-14-4-1-5-15(21)19(14)9-10-25(22,23)18-8-6-12(11-18)24-13-3-2-7-16-17-13/h2-3,7,12H,1,4-6,8-11H2 |
| InChIKey | SBAMUKCSHRXTSG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|