C18H26N4O5S — CID 122260579
1-[2-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 122260579) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-[2-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 122260579 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[2-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | Cc1cc(OC2CCCN(S(=O)(=O)CCN3C(=O)CCCC3=O)C2)nc(C)n1 |
| InChI | InChI=1S/C18H26N4O5S/c1-13-11-16(20-14(2)19-13)27-15-5-4-8-21(12-15)28(25,26)10-9-22-17(23)6-3-7-18(22)24/h11,15H,3-10,12H2,1-2H3 |
| InChIKey | ZDIZKIDMWCJEKL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|