C15H16ClN3O3S — CID 90638526
3-[1-(5-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyridazine (PubChem CID 90638526) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyridazine.
| Compound Name | 3-[1-(5-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyridazine |
|---|---|
| PubChem CID | 90638526 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-[1-(5-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyridazine |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCC(Oc2cccnn2)C1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-11-4-5-12(16)9-14(11)23(20,21)19-8-6-13(10-19)22-15-3-2-7-17-18-15/h2-5,7,9,13H,6,8,10H2,1H3 |
| InChIKey | NBGVWSFRBBVRTO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |