C15H14N4O3S — CID 91627303
4-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylbenzonitrile (PubChem CID 91627303) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylbenzonitrile.
| Compound Name | 4-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 91627303 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-(3-pyridazin-3-yloxypyrrolidin-1-yl)sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(Oc3cccnn3)C2)cc1 |
| InChI | InChI=1S/C15H14N4O3S/c16-10-12-3-5-14(6-4-12)23(20,21)19-9-7-13(11-19)22-15-2-1-8-17-18-15/h1-6,8,13H,7,9,11H2 |
| InChIKey | HWXGZLQRBVBQEL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |