C17H19N3O5S — CID 71799416
methyl 4-(4-pyridazin-3-yloxypiperidin-1-yl)sulfonylbenzoate (PubChem CID 71799416) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 4-(4-pyridazin-3-yloxypiperidin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-(4-pyridazin-3-yloxypiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 71799416 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl 4-(4-pyridazin-3-yloxypiperidin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(Oc3cccnn3)CC2)cc1 |
| InChI | InChI=1S/C17H19N3O5S/c1-24-17(21)13-4-6-15(7-5-13)26(22,23)20-11-8-14(9-12-20)25-16-3-2-10-18-19-16/h2-7,10,14H,8-9,11-12H2,1H3 |
| InChIKey | IBTALLKIWFKSBS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |