C16H18ClN3O3S — CID 90559434
3-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]oxypyridazine (PubChem CID 90559434) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]oxypyridazine.
| Compound Name | 3-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]oxypyridazine |
|---|---|
| PubChem CID | 90559434 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]oxypyridazine |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCC(Oc2cccnn2)CC1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-12-4-5-13(17)11-15(12)24(21,22)20-9-6-14(7-10-20)23-16-3-2-8-18-19-16/h2-5,8,11,14H,6-7,9-10H2,1H3 |
| InChIKey | GGLYXMQMEMOEBV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |