C10H17N3O2S — CID 95982272
4-(imidazol-1-ylmethyl)-1-methylsulfonylpiperidine (PubChem CID 95982272) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-1-methylsulfonylpiperidine.
| Compound Name | 4-(imidazol-1-ylmethyl)-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 95982272 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-1-methylsulfonylpiperidine |
| SMILES | CS(=O)(=O)N1CCC(Cn2ccnc2)CC1 |
| InChI | InChI=1S/C10H17N3O2S/c1-16(14,15)13-5-2-10(3-6-13)8-12-7-4-11-9-12/h4,7,9-10H,2-3,5-6,8H2,1H3 |
| InChIKey | AECPVQWWFOMCEF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |