C15H25N5O2S — CID 18584515
3-(4-methylpiperidin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyridazine (PubChem CID 18584515) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyridazine.
| Compound Name | 3-(4-methylpiperidin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 18584515 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyridazine |
| SMILES | CC1CCN(c2ccc(N3CCN(S(C)(=O)=O)CC3)nn2)CC1 |
| InChI | InChI=1S/C15H25N5O2S/c1-13-5-7-18(8-6-13)14-3-4-15(17-16-14)19-9-11-20(12-10-19)23(2,21)22/h3-4,13H,5-12H2,1-2H3 |
| InChIKey | YPQAXJLFOYHVAX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |