C17H22FN3O4S — CID 27377687
1-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 27377687) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 27377687 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H22FN3O4S/c18-14-4-1-2-5-15(14)19-8-10-20(11-9-19)26(24,25)13-12-21-16(22)6-3-7-17(21)23/h1-2,4-5H,3,6-13H2 |
| InChIKey | VANKDNRWJXYUAK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|