C30H34N4O3 — CID 50832568
[4-(4-methoxyphenyl)piperazin-1-yl]-[1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidin-4-yl]methanone (PubChem CID 50832568) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidin-4-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 50832568 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidin-4-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCN(C(=O)c4cccnc4-c4ccccc4C)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H34N4O3/c1-22-6-3-4-7-26(22)28-27(8-5-15-31-28)30(36)33-16-13-23(14-17-33)29(35)34-20-18-32(19-21-34)24-9-11-25(37-2)12-10-24/h3-12,15,23H,13-14,16-21H2,1-2H3 |
| InChIKey | PYAYVIISNXRDGD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|