C26H33N3O2 — CID 46390267
N-cycloheptyl-1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 46390267) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-cycloheptyl-1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-cycloheptyl-1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46390267 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-cycloheptyl-1-[2-(2-methylphenyl)pyridine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1ccccc1-c1ncccc1C(=O)N1CCC(C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C26H33N3O2/c1-19-9-6-7-12-22(19)24-23(13-8-16-27-24)26(31)29-17-14-20(15-18-29)25(30)28-21-10-4-2-3-5-11-21/h6-9,12-13,16,20-21H,2-5,10-11,14-15,17-18H2,1H3,(H,28,30) |
| InChIKey | KKIHDXLKIRCKCG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |