C22H18ClF3N4O3 — CID 155690302
6-[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]-7-chloroquinoline-5,8-dione (PubChem CID 155690302) has the molecular formula C22H18ClF3N4O3 and a molecular weight of 478.86 g/mol. Its IUPAC name is 6-[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]-7-chloroquinoline-5,8-dione.
| Compound Name | 6-[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]-7-chloroquinoline-5,8-dione |
|---|---|
| PubChem CID | 155690302 |
| Molecular Formula | C22H18ClF3N4O3 |
| Molecular Weight | 478.86 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 6-[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]-7-chloroquinoline-5,8-dione |
| SMILES | CC(=O)N1CCN(c2ccc(NC3=C(Cl)C(=O)c4ncccc4C3=O)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H18ClF3N4O3/c1-12(31)29-7-9-30(10-8-29)16-5-4-13(11-15(16)22(24,25)26)28-19-17(23)21(33)18-14(20(19)32)3-2-6-27-18/h2-6,11,28H,7-10H2,1H3 |
| InChIKey | ZBIIMYXODUJDBO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|