C17H16F3N5O — CID 168544109
2-[[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168544109) has the molecular formula C17H16F3N5O and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544109 |
| Molecular Formula | C17H16F3N5O |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[[4-(4-acetylpiperazin-1-yl)-3-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | CC(=O)N1CCN(c2ccc(NC=C(C#N)C#N)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H16F3N5O/c1-12(26)24-4-6-25(7-5-24)16-3-2-14(8-15(16)17(18,19)20)23-11-13(9-21)10-22/h2-3,8,11,23H,4-7H2,1H3 |
| InChIKey | JUBNBVUWXIBDOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|