C18H20ClN5O — CID 168543218
2-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile (PubChem CID 168543218) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 2-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543218 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC=C(C#N)C#N)cc2Cl)CC1 |
| InChI | InChI=1S/C18H20ClN5O/c1-13(2)18(25)24-7-5-23(6-8-24)17-4-3-15(9-16(17)19)22-12-14(10-20)11-21/h3-4,9,12-13,22H,5-8H2,1-2H3 |
| InChIKey | VYAREAQEYGPLIN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|