C19H22ClN5O — CID 168542836
2-[[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile (PubChem CID 168542836) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542836 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(Cl)cc2NC=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C19H22ClN5O/c1-14(2)9-19(26)25-7-5-24(6-8-25)18-4-3-16(20)10-17(18)23-13-15(11-21)12-22/h3-4,10,13-14,23H,5-9H2,1-2H3 |
| InChIKey | LYYAPWHMBULZMT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|