C21H28ClN3O5 — CID 168569771
dimethyl (E)-2-[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]but-2-enedioate (PubChem CID 168569771) has the molecular formula C21H28ClN3O5 and a molecular weight of 437.92 g/mol. Its IUPAC name is dimethyl (E)-2-[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569771 |
| Molecular Formula | C21H28ClN3O5 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | dimethyl (E)-2-[5-chloro-2-[4-(3-methylbutanoyl)piperazin-1-yl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Cl)ccc1N1CCN(C(=O)CC(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C21H28ClN3O5/c1-14(2)11-19(26)25-9-7-24(8-10-25)18-6-5-15(22)12-16(18)23-17(21(28)30-4)13-20(27)29-3/h5-6,12-14,23H,7-11H2,1-4H3/b17-13+ |
| InChIKey | GGAWKZCEDBXHMA-GHRIWEEISA-N |
| XLogP | 2.68 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|